| product Name |
6-chloro-2,1-benzisothiazol-3-amine |
| Synonyms |
2,1-benzisothiazol-3-amine, 6-chloro-; 6-Chloro-2,1-benzothiazol-3-amine; LogP |
| Molecular Formula |
C7H5ClN2S |
| Molecular Weight |
184.646 |
| InChI |
InChI=1/C7H5ClN2S/c8-4-1-2-5-6(3-4)10-11-7(5)9/h1-3H,9H2 |
| CAS Registry Number |
700-86-7 |
| Molecular Structure |
|
| Density |
1.532g/cm3 |
| Boiling point |
350.8°C at 760 mmHg |
| Refractive index |
1.762 |
| Flash point |
166°C |
| Vapour Pressur |
4.28E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|