product Name |
1,1-dichloro-2,2-difluoroethylene |
Synonyms |
FC-1112a; 1-chloro-1,2,2-trifluoroethene |
Molecular Formula |
C2Cl2F2 |
Molecular Weight |
132.9242 |
InChI |
InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
CAS Registry Number |
79-35-6 |
EINECS |
201-198-3 |
Molecular Structure |
|
Density |
1.503g/cm3 |
Boiling point |
17.3°C at 760 mmHg |
Refractive index |
1.392 |
Vapour Pressur |
999mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R23:Toxic by inhalation.;
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S9:Keep container in a well-ventilated place.;
|
|