| product Name |
4-isopropyl-1-methylcyclohexyl hydroperoxide |
| Synonyms |
4-Isopropyl-1-methylcyclohexyl hydroperoxide; 2-methyl-4-(propan-2-yl)cyclohexyl hydroperoxide |
| Molecular Formula |
C10H20O2 |
| Molecular Weight |
172.2646 |
| InChI |
InChI=1/C10H20O2/c1-7(2)9-4-5-10(12-11)8(3)6-9/h7-11H,4-6H2,1-3H3 |
| CAS Registry Number |
78-58-0 |
| EINECS |
201-125-5 |
| Molecular Structure |
|
| Density |
0.94g/cm3 |
| Boiling point |
249.5°C at 760 mmHg |
| Refractive index |
1.457 |
| Flash point |
104.7°C |
| Vapour Pressur |
0.00366mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|