| product Name |
2',7'-Dichlorofluorescein |
| Molecular Formula |
C20H10Cl2O5 |
| Molecular Weight |
401.1964 |
| InChI |
InChI=1/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)27-18-8-16(24)14(22)6-12(18)19(11)9-3-1-2-4-10(9)20(25)26/h1-8,23H,(H,25,26) |
| CAS Registry Number |
76-54-0 |
| EINECS |
200-968-6 |
| Molecular Structure |
|
| Density |
1.68g/cm3 |
| Melting point |
280℃ |
| Boiling point |
670.7°C at 760 mmHg |
| Refractive index |
1.757 |
| Flash point |
359.4°C |
| Vapour Pressur |
6.63E-19mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|