| product Name |
L-Valine |
| Synonyms |
L-2-Amino-3-methylbutyric acid; L-Valine, FCC Grade L-2-Amino-3-methylbutyric acid, FCC Grade; H-Val-OH; 2-Amino-3-methylbutanoic acid; Lvaline; L-2-Aminoisovaleric acid; (S)-(+)-2-Amino-3-methylbutyric acid |
| Molecular Formula |
C5H11NO2 |
| Molecular Weight |
117.1478 |
| InChI |
InChI:1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
| CAS Registry Number |
72-18-4 |
| EINECS |
200-773-6 |
| Molecular Structure |
|
| Melting point |
315℃ |
| Refractive index |
1.507 |
| Water solubility |
85 g/L (20℃) |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
