| product Name |
DL-Mercaptosuccinic acid |
| Synonyms |
Thiomalic acid; Mercaptosuccinic acid; (2S)-2-sulfanylbutanedioic acid |
| Molecular Formula |
C4H6O4S |
| Molecular Weight |
150.153 |
| InChI |
InChI=1/C4H6O4S/c5-3(6)1-2(9)4(7)8/h2,9H,1H2,(H,5,6)(H,7,8)/t2-/m0/s1 |
| CAS Registry Number |
70-49-5 |
| EINECS |
200-736-4 |
| Molecular Structure |
|
| Density |
1.528g/cm3 |
| Melting point |
152-155℃ |
| Boiling point |
256.3°C at 760 mmHg |
| Refractive index |
1.555 |
| Flash point |
108.8°C |
| Water solubility |
150 g/L (20℃) |
| Vapour Pressur |
0.00475mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
R36/37/38:;
|
| Safety Description |
S26:;
S36/37/39:;
|
|