| product Name |
mephenoxalone |
| Synonyms |
5-(2-methoxyphenoxymethyl)-2-oxazolidone; 5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one |
| Molecular Formula |
C11H13NO4 |
| Molecular Weight |
223.2252 |
| InChI |
InChI=1/C11H13NO4/c1-14-9-4-2-3-5-10(9)15-7-8-6-12-11(13)16-8/h2-5,8H,6-7H2,1H3,(H,12,13) |
| CAS Registry Number |
70-07-5 |
| EINECS |
200-723-3 |
| Molecular Structure |
|
| Density |
1.201g/cm3 |
| Boiling point |
440°C at 760 mmHg |
| Refractive index |
1.52 |
| Flash point |
219.9°C |
| Vapour Pressur |
6.09E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|