| product Name |
N-benzyl-N-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]pyrazine-2-carboxamide |
| Synonyms |
|
| Molecular Formula |
C21H26N4O3 |
| Molecular Weight |
382.4561 |
| InChI |
InChI=1/C21H26N4O3/c1-16-13-25(14-17(2)28-16)20(26)8-11-24(15-18-6-4-3-5-7-18)21(27)19-12-22-9-10-23-19/h3-7,9-10,12,16-17H,8,11,13-15H2,1-2H3 |
| CAS Registry Number |
6038-84-2 |
| Molecular Structure |
|
| Density |
1.183g/cm3 |
| Boiling point |
613.5°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
324.8°C |
| Vapour Pressur |
5.47E-15mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|