| product Name |
methyl 2-amino-4,6-O-benzylidene-2-deoxyhexopyranoside |
| Synonyms |
|
| Molecular Formula |
C14H19NO5 |
| Molecular Weight |
281.3044 |
| InChI |
InChI=1/C14H19NO5/c1-17-14-10(15)11(16)12-9(19-14)7-18-13(20-12)8-5-3-2-4-6-8/h2-6,9-14,16H,7,15H2,1H3 |
| CAS Registry Number |
6038-60-4 |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Boiling point |
465.7°C at 760 mmHg |
| Refractive index |
1.586 |
| Flash point |
235.4°C |
| Vapour Pressur |
1.8E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|