| product Name |
DL-Homocysteinethiolactone hydrochloride |
| Synonyms |
D,L-homocysteinethiolactone HCl; DL-Homocysteine thiolactone hydrochloride; DL-Homocysteine Thiolactone Hydrocloride; 3-aminodihydrothiophen-2(3H)-one hydrochloride (1:1); (3R)-3-aminodihydrothiophen-2(3H)-one hydrochloride (1:1) |
| Molecular Formula |
C4H8ClNOS |
| Molecular Weight |
153.6304 |
| InChI |
InChI=1/C4H7NOS.ClH/c5-3-1-2-7-4(3)6;/h3H,1-2,5H2;1H/t3-;/m1./s1 |
| CAS Registry Number |
6038-19-3 |
| EINECS |
227-923-3 |
| Molecular Structure |
|
| Melting point |
199-203℃ |
| Boiling point |
253.8°C at 760 mmHg |
| Flash point |
107.3°C |
| Water solubility |
740.5 g/L (20 C) |
| Vapour Pressur |
0.0179mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:;
|
|