| product Name |
2-{[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl}-4-(furan-2-yl)-6-methylpyridine-3-carbonitrile |
| Synonyms |
2-{[2-(3,4-Dihydroxyphenyl)-2-oxoethyl]sulfanyl}-4-(2-furyl)-6-methylnicotinonitrile; 3-pyridinecarbonitrile, 2-[[2-(3,4-dihydroxyphenyl)-2-oxoethyl]thio]-4-(2-furanyl)-6-methyl- |
| Molecular Formula |
C19H14N2O4S |
| Molecular Weight |
366.3905 |
| InChI |
InChI=1/C19H14N2O4S/c1-11-7-13(18-3-2-6-25-18)14(9-20)19(21-11)26-10-17(24)12-4-5-15(22)16(23)8-12/h2-8,22-23H,10H2,1H3 |
| CAS Registry Number |
6037-97-4 |
| Molecular Structure |
|
| Density |
1.47g/cm3 |
| Boiling point |
643.1°C at 760 mmHg |
| Refractive index |
1.703 |
| Flash point |
342.7°C |
| Vapour Pressur |
3.89E-17mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|