| product Name |
3-(3-chlorophenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one |
| Synonyms |
3-(3-Chloro-phenyl)-2-(4-nitro-phenyl)-thiazolidin-4-one |
| Molecular Formula |
C15H11ClN2O3S |
| Molecular Weight |
334.7774 |
| InChI |
InChI=1/C15H11ClN2O3S/c16-11-2-1-3-13(8-11)17-14(19)9-22-15(17)10-4-6-12(7-5-10)18(20)21/h1-8,15H,9H2 |
| CAS Registry Number |
6036-85-7 |
| Molecular Structure |
|
| Density |
1.468g/cm3 |
| Boiling point |
624.1°C at 760 mmHg |
| Refractive index |
1.678 |
| Flash point |
331.3°C |
| Vapour Pressur |
1.69E-15mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|