| product Name |
N-{7-[bis(2-chloroethyl)amino]-9H-fluoren-2-yl}propanamide |
| Synonyms |
|
| Molecular Formula |
C20H22Cl2N2O |
| Molecular Weight |
377.3075 |
| InChI |
InChI=1/C20H22Cl2N2O/c1-2-20(25)23-16-3-5-18-14(12-16)11-15-13-17(4-6-19(15)18)24(9-7-21)10-8-22/h3-6,12-13H,2,7-11H2,1H3,(H,23,25) |
| CAS Registry Number |
6036-78-8 |
| Molecular Structure |
|
| Density |
1.293g/cm3 |
| Boiling point |
609°C at 760 mmHg |
| Refractive index |
1.646 |
| Flash point |
322.1°C |
| Vapour Pressur |
8.98E-15mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|