product Name |
alpha-furildioxime monohydrate, mixture of I |
Synonyms |
alpha-Furil dioxime monohydrate; alpha-Furildioxime,mixture of isomers monohydrate; 2,2-Furyldioxime monohydrate |
Molecular Formula |
C10H10N2O5 |
Molecular Weight |
238.1968 |
InChI |
InChI=1/C10H8N2O4.H2O/c13-11-9(7-3-1-5-15-7)10(12-14)8-4-2-6-16-8;/h1-6,11,13H;1H2/b10-9+; |
CAS Registry Number |
6035-71-8 |
Molecular Structure |
|
Melting point |
166-168℃ |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|