| product Name |
(1E)-1-(hydroxyimino)hexane-2,3,4,5-tetrol (non-preferred name) |
| Synonyms |
|
| Molecular Formula |
C6H13NO5 |
| Molecular Weight |
179.1711 |
| InChI |
InChI=1/C6H13NO5/c1-3(8)5(10)6(11)4(9)2-7-12/h2-6,8-12H,1H3/b7-2+ |
| CAS Registry Number |
6035-60-5;6336-63-6 |
| Molecular Structure |
|
| Density |
1.501g/cm3 |
| Boiling point |
511.742°C at 760 mmHg |
| Refractive index |
1.538 |
| Flash point |
342.341°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|