| product Name |
(3R)-6,7-dimethoxy-3-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-2-benzofuran-1(3H)-one |
| Synonyms |
|
| Molecular Formula |
C22H23NO7 |
| Molecular Weight |
413.4205 |
| InChI |
InChI=1/C22H23NO7/c1-23-8-7-11-9-14-20(29-10-28-14)21(27-4)15(11)17(23)18-12-5-6-13(25-2)19(26-3)16(12)22(24)30-18/h5-6,9,17-18H,7-8,10H2,1-4H3/t17-,18+/m0/s1 |
| CAS Registry Number |
6035-40-1 |
| Molecular Structure |
|
| Density |
1.332g/cm3 |
| Boiling point |
565.3°C at 760 mmHg |
| Refractive index |
1.602 |
| Flash point |
295.7°C |
| Vapour Pressur |
8.42E-13mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|