| product Name |
6-amino-3-phenyl-4-(1-phenylethyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| Synonyms |
|
| Molecular Formula |
C21H18N4O |
| Molecular Weight |
342.3938 |
| InChI |
InChI=1/C21H18N4O/c1-13(14-8-4-2-5-9-14)17-16(12-22)20(23)26-21-18(17)19(24-25-21)15-10-6-3-7-11-15/h2-11,13,17H,23H2,1H3,(H,24,25) |
| CAS Registry Number |
6033-83-6 |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Boiling point |
611.5°C at 760 mmHg |
| Refractive index |
1.686 |
| Flash point |
323.6°C |
| Vapour Pressur |
6.79E-15mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|