| product Name |
(4-fluorophenyl)[4-(3-phenoxybenzyl)piperazin-1-yl]methanone |
| Synonyms |
methanone, (4-fluorophenyl)[4-[(3-phenoxyphenyl)methyl]-1-piperazinyl]- |
| Molecular Formula |
C24H23FN2O2 |
| Molecular Weight |
390.45 |
| InChI |
InChI=1/C24H23FN2O2/c25-21-11-9-20(10-12-21)24(28)27-15-13-26(14-16-27)18-19-5-4-8-23(17-19)29-22-6-2-1-3-7-22/h1-12,17H,13-16,18H2 |
| CAS Registry Number |
6033-08-5 |
| Molecular Structure |
|
| Density |
1.225g/cm3 |
| Boiling point |
533.9°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
276.7°C |
| Vapour Pressur |
1.77E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|