| product Name |
methyl 6-(4-oxo-1,3-thiazolidin-2-yl)hexanoate |
| Synonyms |
|
| Molecular Formula |
C10H17NO3S |
| Molecular Weight |
231.3119 |
| InChI |
InChI=1/C10H17NO3S/c1-14-10(13)6-4-2-3-5-9-11-8(12)7-15-9/h9H,2-7H2,1H3,(H,11,12) |
| CAS Registry Number |
6032-95-7 |
| Molecular Structure |
|
| Density |
1.132g/cm3 |
| Boiling point |
406.2°C at 760 mmHg |
| Refractive index |
1.496 |
| Flash point |
199.4°C |
| Vapour Pressur |
8.31E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|