| product Name |
4-phenyl-5-{2-[4-(propan-2-yloxy)phenyl]ethyl}-2,4-dihydro-3H-1,2,4-triazole-3-thione |
| Synonyms |
4H-1,2,4-Triazole-3-thiol, 5-[2-[4-(1-methylethoxy)phenyl]ethyl]-4-phenyl-; 5-[2-(4-Isopropoxyphenyl)ethyl]-4-phenyl-4H-1,2,4-triazole-3-thiol |
| Molecular Formula |
C19H21N3OS |
| Molecular Weight |
339.4545 |
| InChI |
InChI=1/C19H21N3OS/c1-14(2)23-17-11-8-15(9-12-17)10-13-18-20-21-19(24)22(18)16-6-4-3-5-7-16/h3-9,11-12,14H,10,13H2,1-2H3,(H,21,24) |
| CAS Registry Number |
6032-74-2 |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Boiling point |
462.6°C at 760 mmHg |
| Refractive index |
1.621 |
| Flash point |
233.6°C |
| Vapour Pressur |
9.72E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|