| product Name |
4-phenyl-7,8,9,10-tetrahydro-6H-cyclohepta[4,5]thieno[3,2-e][1,2,4]triazolo[4,3-a]pyrimidin-5(4H)-one |
| Synonyms |
4-Phenyl-7,8,9,10-tetrahydro-6H-cyclohepta[4,5]thieno[3,2-e][1,2,4]triazolo[4,3-a]pyrimidin-5(4H)-one; 6H-Cyclohepta[4,5]thieno[3,2-e][1,2,4]triazolo[4,3-a]pyrimidin-5(4H)-one, 7,8,9,10-tetrahydro-4-phenyl- |
| Molecular Formula |
C18H16N4OS |
| Molecular Weight |
336.4108 |
| InChI |
InChI=1/C18H16N4OS/c23-16-15-13-9-5-2-6-10-14(13)24-17(15)21-11-19-20-18(21)22(16)12-7-3-1-4-8-12/h1,3-4,7-8,11H,2,5-6,9-10H2 |
| CAS Registry Number |
6032-72-0 |
| Molecular Structure |
|
| Density |
1.51g/cm3 |
| Boiling point |
647.1°C at 760 mmHg |
| Refractive index |
1.803 |
| Flash point |
345.1°C |
| Vapour Pressur |
1.24E-16mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|