| product Name |
(2E)-3-(4-ethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
| Synonyms |
|
| Molecular Formula |
C17H15FO2 |
| Molecular Weight |
270.2982 |
| InChI |
InChI=1/C17H15FO2/c1-2-20-16-10-3-13(4-11-16)5-12-17(19)14-6-8-15(18)9-7-14/h3-12H,2H2,1H3/b12-5+ |
| CAS Registry Number |
6029-58-9 |
| Molecular Structure |
|
| Density |
1.152g/cm3 |
| Boiling point |
419.2°C at 760 mmHg |
| Refractive index |
1.583 |
| Flash point |
200°C |
| Vapour Pressur |
3.1E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|