| product Name |
(2E)-1-(4-ethoxyphenyl)-3-thiophen-2-ylprop-2-en-1-one |
| Synonyms |
|
| Molecular Formula |
C15H14O2S |
| Molecular Weight |
258.3355 |
| InChI |
InChI=1/C15H14O2S/c1-2-17-13-7-5-12(6-8-13)15(16)10-9-14-4-3-11-18-14/h3-11H,2H2,1H3/b10-9+ |
| CAS Registry Number |
6028-88-2 |
| Molecular Structure |
|
| Density |
1.175g/cm3 |
| Boiling point |
417°C at 760 mmHg |
| Refractive index |
1.615 |
| Flash point |
206°C |
| Vapour Pressur |
3.67E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|