| product Name |
1-Deoxy-1-nitro-L-mannitol |
| Synonyms |
- |
| Molecular Formula |
C6H13NO7 |
| Molecular Weight |
211.1699 |
| InChI |
InChI=1/C6H13NO7/c8-2-4(10)6(12)5(11)3(9)1-7(13)14/h3-6,8-12H,1-2H2/t3-,4-,5-,6-/m0/s1 |
| CAS Registry Number |
6027-42-5 |
| EINECS |
227-894-7 |
| Molecular Structure |
|
| Density |
1.632g/cm3 |
| Melting point |
133℃ |
| Boiling point |
608.3°C at 760 mmHg |
| Refractive index |
1.585 |
| Flash point |
268.9°C |
| Vapour Pressur |
2.45E-17mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
