| product Name |
N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-2-(4-methoxyphenoxy)acetamide |
| Synonyms |
|
| Molecular Formula |
C22H16Cl2N2O4 |
| Molecular Weight |
443.2794 |
| InChI |
InChI=1/C22H16Cl2N2O4/c1-28-15-4-6-16(7-5-15)29-12-21(27)25-14-3-9-20-19(11-14)26-22(30-20)17-8-2-13(23)10-18(17)24/h2-11H,12H2,1H3,(H,25,27) |
| CAS Registry Number |
6025-49-6 |
| Molecular Structure |
|
| Density |
1.41g/cm3 |
| Boiling point |
646.4°C at 760 mmHg |
| Refractive index |
1.66 |
| Flash point |
344.7°C |
| Vapour Pressur |
1.35E-16mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|