| product Name |
6-heptyl-1,3,5-triazine-2,4-diamine |
| Synonyms |
6-Heptyl-1,3,5-triazine-2,4-diamine |
| Molecular Formula |
C10H19N5 |
| Molecular Weight |
209.2914 |
| InChI |
InChI=1/C10H19N5/c1-2-3-4-5-6-7-8-13-9(11)15-10(12)14-8/h2-7H2,1H3,(H4,11,12,13,14,15) |
| CAS Registry Number |
6025-08-7 |
| EINECS |
227-882-1 |
| Molecular Structure |
|
| Density |
1.107g/cm3 |
| Boiling point |
436.2°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
247.7°C |
| Vapour Pressur |
8.22E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|