| product Name |
(2E)-N-benzyl-3-(5-bromo-2,4-dimethoxyphenyl)-2-cyanoprop-2-enamide |
| Synonyms |
(2E)-N-Benzyl-3-(5-bromo-2,4-dimethoxyphenyl)-2-cyanoacrylamide; 2-propenamide, 3-(5-bromo-2,4-dimethoxyphenyl)-2-cyano-N-(phenylmethyl)-, (2E)- |
| Molecular Formula |
C19H17BrN2O3 |
| Molecular Weight |
401.2539 |
| InChI |
InChI=1/C19H17BrN2O3/c1-24-17-10-18(25-2)16(20)9-14(17)8-15(11-21)19(23)22-12-13-6-4-3-5-7-13/h3-10H,12H2,1-2H3,(H,22,23)/b15-8+ |
| CAS Registry Number |
6024-07-3 |
| Molecular Structure |
|
| Density |
1.395g/cm3 |
| Boiling point |
624.2°C at 760 mmHg |
| Refractive index |
1.615 |
| Flash point |
331.3°C |
| Vapour Pressur |
1.69E-15mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|