| product Name |
(2E)-3-(4-chlorophenyl)-N-[4-(morpholin-4-yl)phenyl]prop-2-enamide |
| Synonyms |
|
| Molecular Formula |
C19H19ClN2O2 |
| Molecular Weight |
342.8194 |
| InChI |
InChI=1/C19H19ClN2O2/c20-16-4-1-15(2-5-16)3-10-19(23)21-17-6-8-18(9-7-17)22-11-13-24-14-12-22/h1-10H,11-14H2,(H,21,23)/b10-3+ |
| CAS Registry Number |
6023-70-7 |
| Molecular Structure |
|
| Density |
1.285g/cm3 |
| Boiling point |
588.9°C at 760 mmHg |
| Refractive index |
1.656 |
| Flash point |
310°C |
| Vapour Pressur |
7.58E-14mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|