| product Name |
Creatine Monohydrate |
| Synonyms |
Amidinosarcosine Monohydrate; N-carbamimidoyl-N-methylglycine hydrate (1:1); [(diaminomethylidene)(methyl)ammonio]acetate |
| Molecular Formula |
C4H9N3O2 |
| Molecular Weight |
131.1332 |
| InChI |
InChI=1/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H4,5,6,8,9) |
| CAS Registry Number |
6020-87-7 |
| EINECS |
200-306-6 |
| Molecular Structure |
|
| Melting point |
292℃ |
| Water solubility |
13 g/L (20℃) |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
|
|