product Name |
2,4-Diamino-5-phenylthiazole monohydrobromide |
Synonyms |
Amiphenazole monohydrobromide; 5-phenyl-1,3-thiazole-2,4-diamine hydrobromide (1:1) |
Molecular Formula |
C9H10BrN3S |
Molecular Weight |
272.1648 |
InChI |
InChI=1/C9H9N3S.BrH/c10-8-7(13-9(11)12-8)6-4-2-1-3-5-6;/h1-5H,10H2,(H2,11,12);1H |
CAS Registry Number |
6020-54-8 |
EINECS |
227-874-8 |
Molecular Structure |
|
Melting point |
283℃ |
Boiling point |
413.3°C at 760 mmHg |
Flash point |
203.7°C |
Vapour Pressur |
4.86E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|