| product Name |
4-methoxybenzyl (2E)-2-{3-[(9-ethyl-9H-carbazol-3-yl)amino]-1-methyl-3-oxopropylidene}hydrazinecarboxylate |
| Synonyms |
hydrazinecarboxylic acid, 2-[3-[(9-ethyl-9H-carbazol-3-yl)amino]-1-methyl-3-oxopropylidene]-, (4-methoxyphenyl)methyl ester, (2E)- |
| Molecular Formula |
C27H28N4O4 |
| Molecular Weight |
472.5356 |
| InChI |
InChI=1/C27H28N4O4/c1-4-31-24-8-6-5-7-22(24)23-16-20(11-14-25(23)31)28-26(32)15-18(2)29-30-27(33)35-17-19-9-12-21(34-3)13-10-19/h5-14,16H,4,15,17H2,1-3H3,(H,28,32)(H,30,33)/b29-18+ |
| CAS Registry Number |
6020-34-4 |
| Molecular Structure |
|
| Density |
1.23g/cm3 |
| Refractive index |
1.616 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|