| product Name |
2-(4-chlorophenoxy)-N-[2-methyl-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide |
| Synonyms |
|
| Molecular Formula |
C23H19ClN2O3 |
| Molecular Weight |
406.8616 |
| InChI |
InChI=1/C23H19ClN2O3/c1-14-6-11-21-20(12-14)26-23(29-21)18-4-3-5-19(15(18)2)25-22(27)13-28-17-9-7-16(24)8-10-17/h3-12H,13H2,1-2H3,(H,25,27) |
| CAS Registry Number |
6019-65-4 |
| Molecular Structure |
|
| Density |
1.308g/cm3 |
| Boiling point |
595.5°C at 760 mmHg |
| Refractive index |
1.655 |
| Flash point |
314°C |
| Vapour Pressur |
3.77E-14mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|