| product Name |
arecaidine hydrochloride |
| Synonyms |
1-Methyl-1,2,5,6-tetrahydronicotinic acid hydrochloride; 5-carboxy-1-methyl-1,2,3,6-tetrahydropyridinium chloride |
| Molecular Formula |
C7H12ClNO2 |
| Molecular Weight |
177.6287 |
| InChI |
InChI=1/C7H11NO2.ClH/c1-8-4-2-3-6(5-8)7(9)10;/h3H,2,4-5H2,1H3,(H,9,10);1H |
| CAS Registry Number |
6018-28-6 |
| Molecular Structure |
|
| Boiling point |
266.7°C at 760 mmHg |
| Flash point |
115.1°C |
| Vapour Pressur |
0.00245mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
