| product Name |
2-Amino-4-anilino-1,3,5-triazine hydrochloride |
| Synonyms |
2-Amino-4-phenylamino-1,3,5-triazine hydrochloride; N-phenyl-1,3,5-triazine-2,4-diamine; 1,3,5-triazine-2,4-diamine, N-phenyl-, chloride |
| Molecular Formula |
C9H9ClN5 |
| Molecular Weight |
222.6548 |
| InChI |
InChI=1/C9H9N5.ClH/c10-8-11-6-12-9(14-8)13-7-4-2-1-3-5-7;/h1-6H,(H3,10,11,12,13,14);1H/p-1 |
| CAS Registry Number |
6011-10-5 |
| EINECS |
227-864-3 |
| Molecular Structure |
|
| Boiling point |
432.7°C at 760 mmHg |
| Flash point |
215.5°C |
| Vapour Pressur |
1.09E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
