| product Name |
Formaldehyde, oligomeric reaction products with acetone and diphenylamine |
| Synonyms |
Formaldehyde, polymer with N-phenylbenzenamine and 2-propanone; 2-Propanone, polymer with formaldehyde and N-phenylbenzenamine; acetone; formaldehyde; N-phenylaniline |
| Molecular Formula |
C16H19NO2 |
| Molecular Weight |
257.3276 |
| InChI |
InChI=1/C12H11N.C3H6O.CH2O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4;1-2/h1-10,13H;1-2H3;1H2 |
| CAS Registry Number |
9003-80-9 |
| EINECS |
500-011-5 |
| Molecular Structure |
|
| Boiling point |
302°C at 760 mmHg |
| Flash point |
152.8°C |
| Vapour Pressur |
0.00102mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
