| product Name |
Octanolactone |
| Synonyms |
5-Hydroxyoctanoic acid lactone~delta-Octalactone~1,5-Octanolide; 6-propyltetrahydro-2H-pyran-2-one |
| Molecular Formula |
C8H14O2 |
| Molecular Weight |
142.1956 |
| InChI |
InChI=1/C8H14O2/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3 |
| CAS Registry Number |
698-76-0 |
| EINECS |
211-820-5 |
| Molecular Structure |
|
| Density |
0.96g/cm3 |
| Boiling point |
239.8°C at 760 mmHg |
| Refractive index |
1.436 |
| Flash point |
92.2°C |
| Vapour Pressur |
0.0394mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
