| product Name |
Nepsilon-Acetyl-L-lysine |
| Molecular Formula |
C8H16N2O3 |
| Molecular Weight |
188.2242 |
| InChI |
InChI=1/C8H16N2O3/c1-6(11)10-5-3-2-4-7(9)8(12)13/h7H,2-5,9H2,1H3,(H,10,11)(H,12,13) |
| CAS Registry Number |
692-04-6 |
| EINECS |
211-725-9 |
| Molecular Structure |
|
| Density |
1.139g/cm3 |
| Melting point |
250℃ |
| Boiling point |
442°C at 760 mmHg |
| Refractive index |
1.49 |
| Flash point |
221.1°C |
| Vapour Pressur |
4.76E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
