| product Name |
Chloro(diethyl)phosphine |
| Synonyms |
Diethylchlorophosphine; diethylphosphinous chloride |
| Molecular Formula |
C4H10ClP |
| Molecular Weight |
124.549 |
| InChI |
InChI=1/C4H10ClP/c1-3-6(5)4-2/h3-4H2,1-2H3 |
| CAS Registry Number |
686-69-1 |
| EINECS |
211-689-4 |
| Molecular Structure |
|
| Boiling point |
133.5°C at 760 mmHg |
| Flash point |
18.9°C |
| Vapour Pressur |
10.4mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 C:Corrosive;
|
| Risk Codes |
R11:Highly flammable.;
R14:Reacts violently with water.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S8:Keep container dry.;
|
