| product Name |
4-Phenylimidazole |
| Synonyms |
1H-imidazole, 4-phenyl-; 1H-imidazole, 5-phenyl-; 4-Phenyl-1H-imidazol; 4-phenyl-1H-imidazole; 5-Phenyl-1H-imidazole; 5-phenyl-1H-imidazole hydrochloride (1:1) |
| Molecular Formula |
C9H9ClN2 |
| Molecular Weight |
180.6342 |
| InChI |
InChI=1/C9H8N2.ClH/c1-2-4-8(5-3-1)9-6-10-7-11-9;/h1-7H,(H,10,11);1H |
| CAS Registry Number |
670-95-1 |
| EINECS |
211-580-1 |
| Molecular Structure |
|
| Melting point |
128-131℃ |
| Boiling point |
379.8°C at 760 mmHg |
| Flash point |
213°C |
| Vapour Pressur |
1.24E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|