| product Name |
4,5-Diphenylimidazole |
| Synonyms |
4,5-Diphenyl-1H-imidazole; NSC 59776; 1H-Imidazole, 4,5-diphenyl- (9CI); Imidazole, 4,5-diphenyl- (8CI) |
| Molecular Formula |
C15H12N2 |
| Molecular Weight |
220.2692 |
| InChI |
InChI=1/C15H12N2/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) |
| CAS Registry Number |
668-94-0 |
| EINECS |
211-573-3 |
| Molecular Structure |
|
| Density |
1.149g/cm3 |
| Melting point |
229-233℃ |
| Boiling point |
423.4°C at 760 mmHg |
| Refractive index |
1.627 |
| Flash point |
223.7°C |
| Vapour Pressur |
5.51E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
