| product Name |
Acetone-d6 |
| Synonyms |
Acetone-d6 + 0.05% v/v TMS; ACETONE-D; propan-2-one; (~2~H_6_)propan-2-one |
| Molecular Formula |
C3D6O |
| Molecular Weight |
64.1161 |
| InChI |
InChI=1/C3H6O/c1-3(2)4/h1-2H3/i1D3,2D3 |
| CAS Registry Number |
666-52-4 |
| EINECS |
211-563-9 |
| Molecular Structure |
|
| Density |
0.852g/cm3 |
| Melting point |
-94℃ |
| Boiling point |
46.5°C at 760 mmHg |
| Refractive index |
1.345 |
| Vapour Pressur |
348mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 Xi:Irritant;
|
| Risk Codes |
R11:Highly flammable.;
R36:Irritating to eyes.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S9:Keep container in a well-ventilated place.;
|
