| product Name | 
    4-fluorophenylurea | 
   
  
  
    | Synonyms | 
    Urea, 1-(p-fluorophenyl)-; (4-Fluorophenyl)urea; 1-(p-Fluorophenyl)urea; 4-12-00-01108 (Beilstein Handbook Reference); BRN 2090131; 1-(4-fluorophenyl)urea; 1-(4-fluorophenyl)-1H-pyrrole | 
   
  
  
  
    | Molecular Formula | 
    C10H8FN | 
   
  
  
  
    | Molecular Weight | 
    161.1756 | 
   
  
  
  
    | InChI | 
    InChI=1/C10H8FN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H | 
   
  
  
  
    | CAS Registry Number | 
    659-30-3 | 
   
  
  
  
  
    | Molecular Structure | 
     
                 | 
   
  
  
  
    | Density | 
    1.07g/cm3 | 
   
  
  
  
   
    | Boiling point | 
    229.7°C at 760 mmHg | 
   
  
  
   
    | Refractive index | 
    1.543 | 
   
  
  
  
    | Flash point | 
    92.7°C | 
   
  
  
  
  
    | Vapour Pressur | 
    0.104mmHg at 25°C | 
   
  
  
  
    | Hazard Symbols | 
    
       
       
       
 | 
   
  
  
  
    | Risk Codes | 
    
       
       
       
 | 
   
  
  
  
    | Safety Description | 
    
              S22:Do not inhale dust.; 
       S24/25:Avoid contact with skin and eyes.; 
       
       
 | 
   
  
  
 
 |