| product Name |
2,2-Difluoro-1,3-benzodioxole-5-carboxylic acid |
| Synonyms |
2,2-difluoro-1,3-benzodioxole-5-carboxylate; 2,2-difluorobenzo[d][1,3]dioxole-5-carboxylic acid;
|
| Molecular Formula |
C8H3F2O4 |
| Molecular Weight |
201.1044 |
| InChI |
InChI=1/C8H4F2O4/c9-8(10)13-5-2-1-4(7(11)12)3-6(5)14-8/h1-3H,(H,11,12)/p-1 |
| CAS Registry Number |
656-46-2 |
| Molecular Structure |
|
| Boiling point |
266.1°C at 760 mmHg |
| Flash point |
114.7°C |
| Vapour Pressur |
0.0044mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
