product Name |
2,5-trifluorobenzodioxole |
Synonyms |
1-Bromo-2-fluorocyclohexane; cyclohexane, 1-bromo-2-fluoro- |
Molecular Formula |
C6H10BrF |
Molecular Weight |
181.046 |
InChI |
InChI=1/C6H10BrF/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2 |
CAS Registry Number |
656-43-9 |
Molecular Structure |
|
Density |
1.4g/cm3 |
Boiling point |
166.7°C at 760 mmHg |
Refractive index |
1.463 |
Flash point |
56.8°C |
Vapour Pressur |
2.32mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|