| product Name |
2,5-trifluorobenzodioxole |
| Synonyms |
1-Bromo-2-fluorocyclohexane; cyclohexane, 1-bromo-2-fluoro- |
| Molecular Formula |
C6H10BrF |
| Molecular Weight |
181.046 |
| InChI |
InChI=1/C6H10BrF/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2 |
| CAS Registry Number |
656-43-9 |
| Molecular Structure |
|
| Density |
1.4g/cm3 |
| Boiling point |
166.7°C at 760 mmHg |
| Refractive index |
1.463 |
| Flash point |
56.8°C |
| Vapour Pressur |
2.32mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|