product Name |
1-(2-fluorophenyl)-2-thiourea |
Synonyms |
2-Fluorophenylthiourea; 1-(2-fluorophenyl)thiourea |
Molecular Formula |
C7H7FN2S |
Molecular Weight |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS Registry Number |
656-32-6 |
Molecular Structure |
|
Density |
1.397g/cm3 |
Melting point |
143-145℃ |
Boiling point |
257°C at 760 mmHg |
Refractive index |
1.692 |
Flash point |
109.2°C |
Vapour Pressur |
0.0149mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R25:Toxic if swallowed.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|