| product Name |
1-(2-fluorophenyl)-2-thiourea |
| Synonyms |
2-Fluorophenylthiourea; 1-(2-fluorophenyl)thiourea |
| Molecular Formula |
C7H7FN2S |
| Molecular Weight |
170.2073 |
| InChI |
InChI=1/C7H7FN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| CAS Registry Number |
656-32-6 |
| Molecular Structure |
|
| Density |
1.397g/cm3 |
| Melting point |
143-145℃ |
| Boiling point |
257°C at 760 mmHg |
| Refractive index |
1.692 |
| Flash point |
109.2°C |
| Vapour Pressur |
0.0149mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
