product Name |
2',3',4',5',6'-Pentafluoroacetophenone |
Synonyms |
2,3,4,5,6-Pentafluoroacetophenone; 1-(pentafluorophenyl)ethanone |
Molecular Formula |
C8H3F5O |
Molecular Weight |
210.1008 |
InChI |
InChI=1/C8H3F5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h1H3 |
CAS Registry Number |
652-29-9 |
EINECS |
211-487-6 |
Molecular Structure |
|
Density |
1.479g/cm3 |
Boiling point |
130.5°C at 760 mmHg |
Refractive index |
1.424 |
Flash point |
65.6°C |
Vapour Pressur |
9.68mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|