| product Name |
2',3',4',5',6'-Pentafluoroacetophenone |
| Synonyms |
2,3,4,5,6-Pentafluoroacetophenone; 1-(pentafluorophenyl)ethanone |
| Molecular Formula |
C8H3F5O |
| Molecular Weight |
210.1008 |
| InChI |
InChI=1/C8H3F5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h1H3 |
| CAS Registry Number |
652-29-9 |
| EINECS |
211-487-6 |
| Molecular Structure |
|
| Density |
1.479g/cm3 |
| Boiling point |
130.5°C at 760 mmHg |
| Refractive index |
1.424 |
| Flash point |
65.6°C |
| Vapour Pressur |
9.68mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
