product Name |
N,N'-ethylenebis(benzamide) |
Synonyms |
N,N-Ethylenebisbenzamide; N,N'-ethane-1,2-diyldibenzamide |
Molecular Formula |
C16H16N2O2 |
Molecular Weight |
268.3104 |
InChI |
InChI=1/C16H16N2O2/c19-15(13-7-3-1-4-8-13)17-11-12-18-16(20)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19)(H,18,20) |
CAS Registry Number |
644-33-7 |
EINECS |
211-414-8 |
Molecular Structure |
|
Density |
1.161g/cm3 |
Melting point |
242℃ |
Boiling point |
581.3°C at 760 mmHg |
Refractive index |
1.587 |
Flash point |
233.3°C |
Vapour Pressur |
1.67E-13mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|