| product Name |
N,N'-ethylenebis(benzamide) |
| Synonyms |
N,N-Ethylenebisbenzamide; N,N'-ethane-1,2-diyldibenzamide |
| Molecular Formula |
C16H16N2O2 |
| Molecular Weight |
268.3104 |
| InChI |
InChI=1/C16H16N2O2/c19-15(13-7-3-1-4-8-13)17-11-12-18-16(20)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19)(H,18,20) |
| CAS Registry Number |
644-33-7 |
| EINECS |
211-414-8 |
| Molecular Structure |
|
| Density |
1.161g/cm3 |
| Melting point |
242℃ |
| Boiling point |
581.3°C at 760 mmHg |
| Refractive index |
1.587 |
| Flash point |
233.3°C |
| Vapour Pressur |
1.67E-13mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|