product Name |
Precocene II |
Synonyms |
6,7-Dimethoxy-2,2-dimethyl-3-chromene; 6,7-dimethoxy-2,2-dimethyl-2H-chromene |
Molecular Formula |
C13H16O3 |
Molecular Weight |
220.2643 |
InChI |
InChI=1/C13H16O3/c1-13(2)6-5-9-7-11(14-3)12(15-4)8-10(9)16-13/h5-8H,1-4H3 |
CAS Registry Number |
644-06-4 |
EINECS |
211-408-5 |
Molecular Structure |
|
Density |
1.063g/cm3 |
Melting point |
44-47℃ |
Boiling point |
300.4°C at 760 mmHg |
Refractive index |
1.513 |
Flash point |
100°C |
Vapour Pressur |
0.00201mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|