| product Name |
cis-1,3-Dimethylcyclohexane |
| Synonyms |
(1R,3S)-1,3-Dimethylcyclohexan; (1R,3S)-1,3-Dimethylcyclohexane; 211-316-5 |
| Molecular Formula |
C8H16 |
| Molecular Weight |
112.2126 |
| InChI |
InChI=1/C8H16/c1-7-4-3-5-8(2)6-7/h7-8H,3-6H2,1-2H3/t7-,8+ |
| CAS Registry Number |
638-04-0 |
| EINECS |
211-316-5 |
| Molecular Structure |
|
| Density |
0.766g/cm3 |
| Melting point |
-76℃ |
| Boiling point |
120.1°C at 760 mmHg |
| Refractive index |
1.42 |
| Flash point |
9.4°C |
| Vapour Pressur |
18.6mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 Xi:Irritant;
|
| Risk Codes |
R11:Highly flammable.;
R38:Irritating to skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S33:Take precautionary measures against static discharges.;
S37:Wear suitable gloves.;
S9:Keep container in a well-ventilated place.;
|
|
