product Name |
Thioacetanilide |
Synonyms |
98%; THIOACETANILIDE 99%; N-phenylethanethioamide |
Molecular Formula |
C8H9NS |
Molecular Weight |
151.2288 |
InChI |
InChI=1/C8H9NS/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
CAS Registry Number |
637-53-6 |
EINECS |
211-288-4 |
Molecular Structure |
|
Density |
1.16g/cm3 |
Melting point |
76-79℃ |
Boiling point |
225.121°C at 760 mmHg |
Refractive index |
1.654 |
Flash point |
89.95°C |
Vapour Pressur |
0.088mmHg at 25°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|